C20H30F3IN4OS — CID 110038968
N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-[[3-(trifluoromethyl)cyclohexyl]amino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110038968) has the molecular formula C20H30F3IN4OS and a molecular weight of 558.45 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-[[3-(trifluoromethyl)cyclohexyl]amino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-[[3-(trifluoromethyl)cyclohexyl]amino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110038968 |
| Molecular Formula | C20H30F3IN4OS |
| Molecular Weight | 558.45 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-[[3-(trifluoromethyl)cyclohexyl]amino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCSc1ccccc1)NC1CCCC(C(F)(F)F)C1.I |
| InChI | InChI=1S/C20H29F3N4OS.HI/c1-27(2)18(28)14-25-19(24-11-12-29-17-9-4-3-5-10-17)26-16-8-6-7-15(13-16)20(21,22)23;/h3-5,9-10,15-16H,6-8,11-14H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | IPUXTJIHYMRZOZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|