C16H26N4OS — CID 111751683
N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-(propan-2-ylamino)methylidene]amino]acetamide (PubChem CID 111751683) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-(propan-2-ylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-(propan-2-ylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111751683 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-(propan-2-ylamino)methylidene]amino]acetamide |
| SMILES | CC(C)N/C(=N\CC(=O)N(C)C)NCCSc1ccccc1 |
| InChI | InChI=1S/C16H26N4OS/c1-13(2)19-16(18-12-15(21)20(3)4)17-10-11-22-14-8-6-5-7-9-14/h5-9,13H,10-12H2,1-4H3,(H2,17,18,19) |
| InChIKey | HSZRYAPGHDRQFX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|