C19H28IN5OS2 — CID 110036742
N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-[2-(1,3-thiazol-2-yl)propylamino]methylidene]amino]acetamide;hydroiodide (PubChem CID 110036742) has the molecular formula C19H28IN5OS2 and a molecular weight of 533.51 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-[2-(1,3-thiazol-2-yl)propylamino]methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-[2-(1,3-thiazol-2-yl)propylamino]methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110036742 |
| Molecular Formula | C19H28IN5OS2 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | N,N-dimethyl-2-[[(2-phenylsulfanylethylamino)-[2-(1,3-thiazol-2-yl)propylamino]methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(CN/C(=N\CC(=O)N(C)C)NCCSc1ccccc1)c1nccs1.I |
| InChI | InChI=1S/C19H27N5OS2.HI/c1-15(18-20-9-12-27-18)13-22-19(23-14-17(25)24(2)3)21-10-11-26-16-7-5-4-6-8-16;/h4-9,12,15H,10-11,13-14H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | QETABSKALPRMQE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|