C14H25N5OS2 — CID 110036291
N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[2-(1,3-thiazol-2-yl)propylamino]methylidene]amino]acetamide (PubChem CID 110036291) has the molecular formula C14H25N5OS2 and a molecular weight of 343.52 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[2-(1,3-thiazol-2-yl)propylamino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[2-(1,3-thiazol-2-yl)propylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110036291 |
| Molecular Formula | C14H25N5OS2 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-[2-(1,3-thiazol-2-yl)propylamino]methylidene]amino]acetamide |
| SMILES | CSCCN/C(=N\CC(=O)N(C)C)NCC(C)c1nccs1 |
| InChI | InChI=1S/C14H25N5OS2/c1-11(13-15-6-8-22-13)9-17-14(16-5-7-21-4)18-10-12(20)19(2)3/h6,8,11H,5,7,9-10H2,1-4H3,(H2,16,17,18) |
| InChIKey | MYVOELBNVPSVSB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|