C13H28N4O3S2 — CID 110047660
N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-(4-methylsulfonylbutan-2-ylamino)methylidene]amino]acetamide (PubChem CID 110047660) has the molecular formula C13H28N4O3S2 and a molecular weight of 352.53 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-(4-methylsulfonylbutan-2-ylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-(4-methylsulfonylbutan-2-ylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110047660 |
| Molecular Formula | C13H28N4O3S2 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylsulfanylethylamino)-(4-methylsulfonylbutan-2-ylamino)methylidene]amino]acetamide |
| SMILES | CSCCN/C(=N\CC(=O)N(C)C)NC(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C13H28N4O3S2/c1-11(6-9-22(5,19)20)16-13(14-7-8-21-4)15-10-12(18)17(2)3/h11H,6-10H2,1-5H3,(H2,14,15,16) |
| InChIKey | HLGKXYLWMLXLLU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|