C20H35N5O3S — CID 110047628
N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(4-methylsulfonylbutan-2-ylamino)methylidene]amino]acetamide (PubChem CID 110047628) has the molecular formula C20H35N5O3S and a molecular weight of 425.60 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(4-methylsulfonylbutan-2-ylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(4-methylsulfonylbutan-2-ylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110047628 |
| Molecular Formula | C20H35N5O3S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(4-methylsulfonylbutan-2-ylamino)methylidene]amino]acetamide |
| SMILES | CC(CCS(C)(=O)=O)N/C(=N\CC(=O)N(C)C)NCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C20H35N5O3S/c1-17(12-15-29(5,27)28)23-20(22-16-19(26)24(2)3)21-13-9-14-25(4)18-10-7-6-8-11-18/h6-8,10-11,17H,9,12-16H2,1-5H3,(H2,21,22,23) |
| InChIKey | SGHWHZNBYALGRV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|