C22H40IN5O2 — CID 110033782
N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(4-propan-2-yloxybutylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110033782) has the molecular formula C22H40IN5O2 and a molecular weight of 533.50 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(4-propan-2-yloxybutylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(4-propan-2-yloxybutylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110033782 |
| Molecular Formula | C22H40IN5O2 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | N,N-dimethyl-2-[[[3-(N-methylanilino)propylamino]-(4-propan-2-yloxybutylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(C)OCCCCN/C(=N\CC(=O)N(C)C)NCCCN(C)c1ccccc1.I |
| InChI | InChI=1S/C22H39N5O2.HI/c1-19(2)29-17-10-9-14-23-22(25-18-21(28)26(3)4)24-15-11-16-27(5)20-12-7-6-8-13-20;/h6-8,12-13,19H,9-11,14-18H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | SFJXOOUTTJIEFL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|