C15H27IN4O3S2 — CID 110047647
N,N-dimethyl-2-[[(4-methylsulfonylbutan-2-ylamino)-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 110047647) has the molecular formula C15H27IN4O3S2 and a molecular weight of 502.44 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(4-methylsulfonylbutan-2-ylamino)-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[(4-methylsulfonylbutan-2-ylamino)-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110047647 |
| Molecular Formula | C15H27IN4O3S2 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | N,N-dimethyl-2-[[(4-methylsulfonylbutan-2-ylamino)-(thiophen-2-ylmethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CC(CCS(C)(=O)=O)N/C(=N\CC(=O)N(C)C)NCc1cccs1.I |
| InChI | InChI=1S/C15H26N4O3S2.HI/c1-12(7-9-24(4,21)22)18-15(17-11-14(20)19(2)3)16-10-13-6-5-8-23-13;/h5-6,8,12H,7,9-11H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | BNQVDOJKOBAZPF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|