C15H27N5OS2 — CID 110047728
2-[[[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethylamino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110047728) has the molecular formula C15H27N5OS2 and a molecular weight of 357.55 g/mol. Its IUPAC name is 2-[[[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethylamino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethylamino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110047728 |
| Molecular Formula | C15H27N5OS2 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-[[[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethylamino]-(2-methylsulfanylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CSCCN/C(=N\CC(=O)N(C)C)NCCc1nc(C)c(C)s1 |
| InChI | InChI=1S/C15H27N5OS2/c1-11-12(2)23-13(19-11)6-7-16-15(17-8-9-22-5)18-10-14(21)20(3)4/h6-10H2,1-5H3,(H2,16,17,18) |
| InChIKey | YZLXOVCORFUMNQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|