C19H35IN6O2S — CID 110047673
2-[[[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110047673) has the molecular formula C19H35IN6O2S and a molecular weight of 538.50 g/mol. Its IUPAC name is 2-[[[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110047673 |
| Molecular Formula | C19H35IN6O2S |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 2-[[[2-(4,5-dimethyl-1,3-thiazol-2-yl)ethylamino]-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | Cc1nc(CCN/C(=N\CC(=O)N(C)C)NCCCN2CCOCC2)sc1C.I |
| InChI | InChI=1S/C19H34N6O2S.HI/c1-15-16(2)28-17(23-15)6-8-21-19(22-14-18(26)24(3)4)20-7-5-9-25-10-12-27-13-11-25;/h5-14H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | BPTFWOBYCHNUII-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|