C22H35N5O3S — CID 111981359
ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111981359) has the molecular formula C22H35N5O3S and a molecular weight of 449.62 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111981359 |
| Molecular Formula | C22H35N5O3S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | ethyl 4-[[N'-[2-(dimethylamino)-2-oxoethyl]-N-(2-phenylsulfanylpropyl)carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/CC(=O)N(C)C)NCC(C)Sc2ccccc2)CC1 |
| InChI | InChI=1S/C22H35N5O3S/c1-5-30-22(29)27-13-11-18(12-14-27)25-21(24-16-20(28)26(3)4)23-15-17(2)31-19-9-7-6-8-10-19/h6-10,17-18H,5,11-16H2,1-4H3,(H2,23,24,25) |
| InChIKey | CGJNOJPOLUVPTP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|