C18H24IN3OS — CID 136920682
2-[2-(furan-2-yl)ethyl]-1-(2-phenylsulfanylethyl)-3-prop-2-enylguanidine;hydroiodide (PubChem CID 136920682) has the molecular formula C18H24IN3OS and a molecular weight of 457.38 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)ethyl]-1-(2-phenylsulfanylethyl)-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-[2-(furan-2-yl)ethyl]-1-(2-phenylsulfanylethyl)-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 136920682 |
| Molecular Formula | C18H24IN3OS |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 2-[2-(furan-2-yl)ethyl]-1-(2-phenylsulfanylethyl)-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\CCc1ccco1)NCCSc1ccccc1.I |
| InChI | InChI=1S/C18H23N3OS.HI/c1-2-11-19-18(20-12-10-16-7-6-14-22-16)21-13-15-23-17-8-4-3-5-9-17;/h2-9,14H,1,10-13,15H2,(H2,19,20,21);1H |
| InChIKey | KWPXFQSMBWHAOH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|