C19H28IN3O3S — CID 111979668
1-[2-(furan-2-yl)ethyl]-2-[2-(2-hydroxyethoxy)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111979668) has the molecular formula C19H28IN3O3S and a molecular weight of 505.42 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-[2-(2-hydroxyethoxy)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-[2-(2-hydroxyethoxy)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111979668 |
| Molecular Formula | C19H28IN3O3S |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-[2-(2-hydroxyethoxy)ethyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | I.OCCOCC/N=C(/NCCSc1ccccc1)NCCc1ccco1 |
| InChI | InChI=1S/C19H27N3O3S.HI/c23-12-15-24-14-10-21-19(20-9-8-17-5-4-13-25-17)22-11-16-26-18-6-2-1-3-7-18;/h1-7,13,23H,8-12,14-16H2,(H2,20,21,22);1H |
| InChIKey | MIXVZMOPXFGMDG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|