C22H32IN3O3S — CID 110059001
1-[2-(furan-2-yl)ethyl]-2-[3-(oxolan-3-yloxy)propyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 110059001) has the molecular formula C22H32IN3O3S and a molecular weight of 545.49 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-[3-(oxolan-3-yloxy)propyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-[3-(oxolan-3-yloxy)propyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110059001 |
| Molecular Formula | C22H32IN3O3S |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-[3-(oxolan-3-yloxy)propyl]-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | I.c1ccc(SCCN/C(=N/CCCOC2CCOC2)NCCc2ccco2)cc1 |
| InChI | InChI=1S/C22H31N3O3S.HI/c1-2-7-21(8-3-1)29-17-13-25-22(24-12-9-19-6-4-14-27-19)23-11-5-15-28-20-10-16-26-18-20;/h1-4,6-8,14,20H,5,9-13,15-18H2,(H2,23,24,25);1H |
| InChIKey | VVPKZAXLVONSLL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|