C25H39IN4O3 — CID 111648605
1-[2-(furan-2-yl)ethyl]-2-[3-(N-methylanilino)propyl]-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111648605) has the molecular formula C25H39IN4O3 and a molecular weight of 570.52 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-[3-(N-methylanilino)propyl]-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-[3-(N-methylanilino)propyl]-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111648605 |
| Molecular Formula | C25H39IN4O3 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-[3-(N-methylanilino)propyl]-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CN(CCC/N=C(\NCCCOCC1CCOC1)NCCc1ccco1)c1ccccc1.I |
| InChI | InChI=1S/C25H38N4O3.HI/c1-29(23-8-3-2-4-9-23)16-6-13-26-25(28-15-11-24-10-5-18-32-24)27-14-7-17-30-20-22-12-19-31-21-22;/h2-5,8-10,18,22H,6-7,11-17,19-21H2,1H3,(H2,26,27,28);1H |
| InChIKey | SNEDIPJRXOJBGZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|