C13H18IN3O — CID 136922974
2-[2-(furan-2-yl)ethyl]-1-prop-2-enyl-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 136922974) has the molecular formula C13H18IN3O and a molecular weight of 359.21 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)ethyl]-1-prop-2-enyl-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 2-[2-(furan-2-yl)ethyl]-1-prop-2-enyl-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 136922974 |
| Molecular Formula | C13H18IN3O |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2-[2-(furan-2-yl)ethyl]-1-prop-2-enyl-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N/CCc1ccco1)NCC=C.I |
| InChI | InChI=1S/C13H17N3O.HI/c1-3-8-14-13(15-9-4-2)16-10-7-12-6-5-11-17-12;/h1,4-6,11H,2,7-10H2,(H2,14,15,16);1H |
| InChIKey | LCIJTNDTMDMHJL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|