C17H27IN6O — CID 110055861
1-[2-(furan-2-yl)ethyl]-2-methyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide (PubChem CID 110055861) has the molecular formula C17H27IN6O and a molecular weight of 458.35 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110055861 |
| Molecular Formula | C17H27IN6O |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(2-propan-2-yl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccco1)NC1CCc2nc(C(C)C)nn2C1.I |
| InChI | InChI=1S/C17H26N6O.HI/c1-12(2)16-21-15-7-6-13(11-23(15)22-16)20-17(18-3)19-9-8-14-5-4-10-24-14;/h4-5,10,12-13H,6-9,11H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | NMKMFZVCYRKWSZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|