C19H29N7O2S — CID 110046753
2-[[[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110046753) has the molecular formula C19H29N7O2S and a molecular weight of 419.56 g/mol. Its IUPAC name is 2-[[[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110046753 |
| Molecular Formula | C19H29N7O2S |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-[[[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-(2-thiophen-2-ylethylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | COCc1nc2n(n1)CC(N/C(=N/CC(=O)N(C)C)NCCc1cccs1)CC2 |
| InChI | InChI=1S/C19H29N7O2S/c1-25(2)18(27)11-21-19(20-9-8-15-5-4-10-29-15)22-14-6-7-17-23-16(13-28-3)24-26(17)12-14/h4-5,10,14H,6-9,11-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | OLAIAUOXFHSRFT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|