C18H28IN7O2S — CID 110046734
2-[[[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110046734) has the molecular formula C18H28IN7O2S and a molecular weight of 533.44 g/mol. Its IUPAC name is 2-[[[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110046734 |
| Molecular Formula | C18H28IN7O2S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 2-[[[[2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-(thiophen-2-ylmethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COCc1nc2n(n1)CC(N/C(=N/CC(=O)N(C)C)NCc1cccs1)CC2.I |
| InChI | InChI=1S/C18H27N7O2S.HI/c1-24(2)17(26)10-20-18(19-9-14-5-4-8-28-14)21-13-6-7-16-22-15(12-27-3)23-25(16)11-13;/h4-5,8,13H,6-7,9-12H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | JNGSXODESVYZPE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|