C20H34N8 — CID 109405731
2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine (PubChem CID 109405731) has the molecular formula C20H34N8 and a molecular weight of 386.55 g/mol. Its IUPAC name is 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine.
| Compound Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
|---|---|
| PubChem CID | 109405731 |
| Molecular Formula | C20H34N8 |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)guanidine |
| SMILES | CCN/C(=N\Cc1c(CC)nn(C)c1CC)NC1CCc2nc(CC)nn2C1 |
| InChI | InChI=1S/C20H34N8/c1-6-16-15(17(7-2)27(5)25-16)12-22-20(21-9-4)23-14-10-11-19-24-18(8-3)26-28(19)13-14/h14H,6-13H2,1-5H3,(H2,21,22,23) |
| InChIKey | GIRNSGQJVRIVAE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|