C22H41N7O — CID 109405141
2-[4-[[N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide (PubChem CID 109405141) has the molecular formula C22H41N7O and a molecular weight of 419.62 g/mol. Its IUPAC name is 2-[4-[[N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[[N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 109405141 |
| Molecular Formula | C22H41N7O |
| Molecular Weight | 419.62 g/mol |
| Exact Mass | 419.34 |
| IUPAC Name | 2-[4-[[N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethylcarbamimidoyl]amino]piperidin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCC(N/C(=N/Cc2c(CC)nn(C)c2CC)NCC)CC1 |
| InChI | InChI=1S/C22H41N7O/c1-6-12-24-21(30)16-29-13-10-17(11-14-29)26-22(23-9-4)25-15-18-19(7-2)27-28(5)20(18)8-3/h17H,6-16H2,1-5H3,(H,24,30)(H2,23,25,26) |
| InChIKey | FLBGHWBMEUKMHE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.62 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|