C20H38N6O2S — CID 109404981
2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(1-propylsulfonylpiperidin-4-yl)guanidine (PubChem CID 109404981) has the molecular formula C20H38N6O2S and a molecular weight of 426.63 g/mol. Its IUPAC name is 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(1-propylsulfonylpiperidin-4-yl)guanidine.
| Compound Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(1-propylsulfonylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 109404981 |
| Molecular Formula | C20H38N6O2S |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 2-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-1-ethyl-3-(1-propylsulfonylpiperidin-4-yl)guanidine |
| SMILES | CCCS(=O)(=O)N1CCC(N/C(=N/Cc2c(CC)nn(C)c2CC)NCC)CC1 |
| InChI | InChI=1S/C20H38N6O2S/c1-6-14-29(27,28)26-12-10-16(11-13-26)23-20(21-9-4)22-15-17-18(7-2)24-25(5)19(17)8-3/h16H,6-15H2,1-5H3,(H2,21,22,23) |
| InChIKey | CMJSWSJAFFKHLO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|