C24H43IN6O2 — CID 109405342
tert-butyl 3-[[N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethylcarbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide (PubChem CID 109405342) has the molecular formula C24H43IN6O2 and a molecular weight of 574.55 g/mol. Its IUPAC name is tert-butyl 3-[[N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethylcarbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethylcarbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109405342 |
| Molecular Formula | C24H43IN6O2 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | tert-butyl 3-[[N'-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N-ethylcarbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1c(CC)nn(C)c1CC)NC1CC2CCC(C1)N2C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C24H42N6O2.HI/c1-8-20-19(21(9-2)29(7)28-20)15-26-22(25-10-3)27-16-13-17-11-12-18(14-16)30(17)23(31)32-24(4,5)6;/h16-18H,8-15H2,1-7H3,(H2,25,26,27);1H |
| InChIKey | UBIQCYNUBGGSDI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|