C23H37IN4O4 — CID 111993620
tert-butyl 3-[[N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide (PubChem CID 111993620) has the molecular formula C23H37IN4O4 and a molecular weight of 560.48 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111993620 |
| Molecular Formula | C23H37IN4O4 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1O)NC1CC2CCC(C1)N2C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C23H36N4O4.HI/c1-6-24-21(25-14-15-8-7-9-19(30-5)20(15)28)26-16-12-17-10-11-18(13-16)27(17)22(29)31-23(2,3)4;/h7-9,16-18,28H,6,10-14H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | VLTQUFPLZSBIKQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|