C18H26F3N3O2 — CID 111991877
1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine (PubChem CID 111991877) has the molecular formula C18H26F3N3O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine.
| Compound Name | 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine |
|---|---|
| PubChem CID | 111991877 |
| Molecular Formula | C18H26F3N3O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1O)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H26F3N3O2/c1-3-22-17(23-11-12-5-4-6-15(26-2)16(12)25)24-14-9-7-13(8-10-14)18(19,20)21/h4-6,13-14,25H,3,7-11H2,1-2H3,(H2,22,23,24) |
| InChIKey | KXPRDMHDAQVZJG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|