C16H26IN3O2S — CID 111999064
1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(thian-3-yl)guanidine;hydroiodide (PubChem CID 111999064) has the molecular formula C16H26IN3O2S and a molecular weight of 451.37 g/mol. Its IUPAC name is 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(thian-3-yl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(thian-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111999064 |
| Molecular Formula | C16H26IN3O2S |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 1-ethyl-2-[(2-hydroxy-3-methoxyphenyl)methyl]-3-(thian-3-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1O)NC1CCCSC1.I |
| InChI | InChI=1S/C16H25N3O2S.HI/c1-3-17-16(19-13-7-5-9-22-11-13)18-10-12-6-4-8-14(21-2)15(12)20;/h4,6,8,13,20H,3,5,7,9-11H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | NREPVYUZANXOOQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|