C20H32IN3O4 — CID 111993390
ethyl 4-[[N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide (PubChem CID 111993390) has the molecular formula C20H32IN3O4 and a molecular weight of 505.40 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111993390 |
| Molecular Formula | C20H32IN3O4 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[(2-hydroxy-3-methoxyphenyl)methyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1O)NC1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C20H31N3O4.HI/c1-4-21-20(22-13-15-7-6-8-17(26-3)18(15)24)23-16-11-9-14(10-12-16)19(25)27-5-2;/h6-8,14,16,24H,4-5,9-13H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | LJFJZAKHCOQXAO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|