C19H29BrIN3O2 — CID 111978095
ethyl 4-[[N'-[(4-bromophenyl)methyl]-N-ethylcarbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide (PubChem CID 111978095) has the molecular formula C19H29BrIN3O2 and a molecular weight of 538.27 g/mol. Its IUPAC name is ethyl 4-[[N'-[(4-bromophenyl)methyl]-N-ethylcarbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[(4-bromophenyl)methyl]-N-ethylcarbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111978095 |
| Molecular Formula | C19H29BrIN3O2 |
| Molecular Weight | 538.27 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | ethyl 4-[[N'-[(4-bromophenyl)methyl]-N-ethylcarbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Br)cc1)NC1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C19H28BrN3O2.HI/c1-3-21-19(22-13-14-5-9-16(20)10-6-14)23-17-11-7-15(8-12-17)18(24)25-4-2;/h5-6,9-10,15,17H,3-4,7-8,11-13H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | RTRLCMXZVSLLAB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|