C18H30IN3O4 — CID 111991762
ethyl 4-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide (PubChem CID 111991762) has the molecular formula C18H30IN3O4 and a molecular weight of 479.36 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111991762 |
| Molecular Formula | C18H30IN3O4 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccco1)NC1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C18H29N3O4.HI/c1-3-19-18(20-12-15(22)16-6-5-11-25-16)21-14-9-7-13(8-10-14)17(23)24-4-2;/h5-6,11,13-15,22H,3-4,7-10,12H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | HYVCLYWFFYHUNS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|