C20H34N4O4 — CID 111993137
tert-butyl N-[4-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]carbamimidoyl]amino]cyclohexyl]carbamate (PubChem CID 111993137) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is tert-butyl N-[4-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]carbamimidoyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]carbamimidoyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 111993137 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | tert-butyl N-[4-[[N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]carbamimidoyl]amino]cyclohexyl]carbamate |
| SMILES | CCN/C(=N\CC(O)c1ccco1)NC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H34N4O4/c1-5-21-18(22-13-16(25)17-7-6-12-27-17)23-14-8-10-15(11-9-14)24-19(26)28-20(2,3)4/h6-7,12,14-16,25H,5,8-11,13H2,1-4H3,(H,24,26)(H2,21,22,23) |
| InChIKey | KRIJPVQAMOJLTG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|