C20H34N4O3 — CID 110055376
tert-butyl N-[4-[[N-ethyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]cyclohexyl]carbamate (PubChem CID 110055376) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is tert-butyl N-[4-[[N-ethyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[N-ethyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 110055376 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | tert-butyl N-[4-[[N-ethyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]amino]cyclohexyl]carbamate |
| SMILES | CCN/C(=N\CCc1ccco1)NC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H34N4O3/c1-5-21-18(22-13-12-17-7-6-14-26-17)23-15-8-10-16(11-9-15)24-19(25)27-20(2,3)4/h6-7,14-16H,5,8-13H2,1-4H3,(H,24,25)(H2,21,22,23) |
| InChIKey | BYRGASODPADHQE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|