C21H33FIN3O4 — CID 111993660
ethyl 4-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide (PubChem CID 111993660) has the molecular formula C21H33FIN3O4 and a molecular weight of 537.41 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111993660 |
| Molecular Formula | C21H33FIN3O4 |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[3-(4-fluorophenoxy)-2-hydroxypropyl]carbamimidoyl]amino]cyclohexane-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(O)COc1ccc(F)cc1)NC1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H32FN3O4.HI/c1-3-23-21(25-17-9-5-15(6-10-17)20(27)28-4-2)24-13-18(26)14-29-19-11-7-16(22)8-12-19;/h7-8,11-12,15,17-18,26H,3-6,9-10,13-14H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | LAUCMRGUWRMLPM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|