C19H35IN6O2 — CID 109466951
tert-butyl 3-[[N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109466951) has the molecular formula C19H35IN6O2 and a molecular weight of 506.43 g/mol. Its IUPAC name is tert-butyl 3-[[N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109466951 |
| Molecular Formula | C19H35IN6O2 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | tert-butyl 3-[[N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N\C)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C19H34N6O2.HI/c1-8-15-14(16(9-2)24(7)23-15)10-21-17(20-6)22-13-11-25(12-13)18(26)27-19(3,4)5;/h13H,8-12H2,1-7H3,(H2,20,21,22);1H |
| InChIKey | JLBUXBZQFPOFAN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|