C14H25N7O2 — CID 109465590
tert-butyl 3-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465590) has the molecular formula C14H25N7O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is tert-butyl 3-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465590 |
| Molecular Formula | C14H25N7O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | tert-butyl 3-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCc1ncnn1C)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H25N7O2/c1-14(2,3)23-13(22)21-7-10(8-21)19-12(15-4)16-6-11-17-9-18-20(11)5/h9-10H,6-8H2,1-5H3,(H2,15,16,19) |
| InChIKey | KCNDKWDLBIFRNQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|