C15H26N6O2 — CID 109466808
tert-butyl 3-[[N'-methyl-N-(2-pyrazol-1-ylethyl)carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109466808) has the molecular formula C15H26N6O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl 3-[[N'-methyl-N-(2-pyrazol-1-ylethyl)carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N'-methyl-N-(2-pyrazol-1-ylethyl)carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109466808 |
| Molecular Formula | C15H26N6O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | tert-butyl 3-[[N'-methyl-N-(2-pyrazol-1-ylethyl)carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | C/N=C(\NCCn1cccn1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H26N6O2/c1-15(2,3)23-14(22)20-10-12(11-20)19-13(16-4)17-7-9-21-8-5-6-18-21/h5-6,8,12H,7,9-11H2,1-4H3,(H2,16,17,19) |
| InChIKey | MEMOSCBWHXFDCV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|