C23H41IN6O2 — CID 109405334
tert-butyl 3-[[N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylcarbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide (PubChem CID 109405334) has the molecular formula C23H41IN6O2 and a molecular weight of 560.53 g/mol. Its IUPAC name is tert-butyl 3-[[N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylcarbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylcarbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109405334 |
| Molecular Formula | C23H41IN6O2 |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | tert-butyl 3-[[N-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-N'-methylcarbamimidoyl]amino]-8-azabicyclo[3.2.1]octane-8-carboxylate;hydroiodide |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N\C)NC1CC2CCC(C1)N2C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C23H40N6O2.HI/c1-8-19-18(20(9-2)28(7)27-19)14-25-21(24-6)26-15-12-16-10-11-17(13-15)29(16)22(30)31-23(3,4)5;/h15-17H,8-14H2,1-7H3,(H2,24,25,26);1H |
| InChIKey | BWOKFZLWIKOGOL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|