C19H35N5OS — CID 109439413
1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine (PubChem CID 109439413) has the molecular formula C19H35N5OS and a molecular weight of 381.59 g/mol. Its IUPAC name is 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine.
| Compound Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109439413 |
| Molecular Formula | C19H35N5OS |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N\C)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C19H35N5OS/c1-6-17-16(18(7-2)24(5)23-17)13-21-19(20-4)22-14-10-9-11-15(12-14)26(25)8-3/h14-15H,6-13H2,1-5H3,(H2,20,21,22) |
| InChIKey | IMALVNQDRKQIHI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|