C20H30IN5OS — CID 109437700
1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(1-phenylpyrazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 109437700) has the molecular formula C20H30IN5OS and a molecular weight of 515.47 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(1-phenylpyrazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(1-phenylpyrazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109437700 |
| Molecular Formula | C20H30IN5OS |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-2-methyl-3-[(1-phenylpyrazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2ccn(-c3ccccc3)n2)C1.I |
| InChI | InChI=1S/C20H29N5OS.HI/c1-3-27(26)19-11-7-8-16(14-19)23-20(21-2)22-15-17-12-13-25(24-17)18-9-5-4-6-10-18;/h4-6,9-10,12-13,16,19H,3,7-8,11,14-15H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | XUPSJOFSWNJLEU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|