C17H29IN4O2S — CID 109437024
1-(3-ethylsulfinylcyclohexyl)-3-[(6-methoxy-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 109437024) has the molecular formula C17H29IN4O2S and a molecular weight of 480.42 g/mol. Its IUPAC name is 1-(3-ethylsulfinylcyclohexyl)-3-[(6-methoxy-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(3-ethylsulfinylcyclohexyl)-3-[(6-methoxy-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109437024 |
| Molecular Formula | C17H29IN4O2S |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 1-(3-ethylsulfinylcyclohexyl)-3-[(6-methoxy-2-pyridinyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCc2cccc(OC)n2)C1.I |
| InChI | InChI=1S/C17H28N4O2S.HI/c1-4-24(22)15-9-5-7-13(11-15)21-17(18-2)19-12-14-8-6-10-16(20-14)23-3;/h6,8,10,13,15H,4-5,7,9,11-12H2,1-3H3,(H2,18,19,21);1H |
| InChIKey | WKTOYRQTVXIZSC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|