C22H34FIN6 — CID 109405412
1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[1-(3-fluorophenyl)piperidin-4-yl]-2-methylguanidine;hydroiodide (PubChem CID 109405412) has the molecular formula C22H34FIN6 and a molecular weight of 528.46 g/mol. Its IUPAC name is 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[1-(3-fluorophenyl)piperidin-4-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[1-(3-fluorophenyl)piperidin-4-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109405412 |
| Molecular Formula | C22H34FIN6 |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 1-[(3,5-diethyl-1-methylpyrazol-4-yl)methyl]-3-[1-(3-fluorophenyl)piperidin-4-yl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nn(C)c(CC)c1CN/C(=N\C)NC1CCN(c2cccc(F)c2)CC1.I |
| InChI | InChI=1S/C22H33FN6.HI/c1-5-20-19(21(6-2)28(4)27-20)15-25-22(24-3)26-17-10-12-29(13-11-17)18-9-7-8-16(23)14-18;/h7-9,14,17H,5-6,10-13,15H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | SSCXQQFJZBITOA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|