C19H32FN5O2S — CID 111992571
1-[2-(diethylsulfamoyl)ethyl]-3-[1-(3-fluorophenyl)piperidin-4-yl]-2-methylguanidine (PubChem CID 111992571) has the molecular formula C19H32FN5O2S and a molecular weight of 413.56 g/mol. Its IUPAC name is 1-[2-(diethylsulfamoyl)ethyl]-3-[1-(3-fluorophenyl)piperidin-4-yl]-2-methylguanidine.
| Compound Name | 1-[2-(diethylsulfamoyl)ethyl]-3-[1-(3-fluorophenyl)piperidin-4-yl]-2-methylguanidine |
|---|---|
| PubChem CID | 111992571 |
| Molecular Formula | C19H32FN5O2S |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 1-[2-(diethylsulfamoyl)ethyl]-3-[1-(3-fluorophenyl)piperidin-4-yl]-2-methylguanidine |
| SMILES | CCN(CC)S(=O)(=O)CCN/C(=N\C)NC1CCN(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H32FN5O2S/c1-4-25(5-2)28(26,27)14-11-22-19(21-3)23-17-9-12-24(13-10-17)18-8-6-7-16(20)15-18/h6-8,15,17H,4-5,9-14H2,1-3H3,(H2,21,22,23) |
| InChIKey | FKEQDYYRCQNPNO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|