C17H24FIN6O — CID 75512867
1-[1-(3-fluorophenyl)piperidin-4-yl]-2-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 75512867) has the molecular formula C17H24FIN6O and a molecular weight of 474.32 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)piperidin-4-yl]-2-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(3-fluorophenyl)piperidin-4-yl]-2-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 75512867 |
| Molecular Formula | C17H24FIN6O |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 1-[1-(3-fluorophenyl)piperidin-4-yl]-2-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1noc(C)n1)NC1CCN(c2cccc(F)c2)CC1.I |
| InChI | InChI=1S/C17H23FN6O.HI/c1-12-21-16(23-25-12)11-20-17(19-2)22-14-6-8-24(9-7-14)15-5-3-4-13(18)10-15;/h3-5,10,14H,6-9,11H2,1-2H3,(H2,19,20,22);1H |
| InChIKey | FRQFUECGQWASGS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|