C21H31FN4O — CID 109394964
2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[1-(3-fluorophenyl)piperidin-4-yl]guanidine (PubChem CID 109394964) has the molecular formula C21H31FN4O and a molecular weight of 374.50 g/mol. Its IUPAC name is 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[1-(3-fluorophenyl)piperidin-4-yl]guanidine.
| Compound Name | 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[1-(3-fluorophenyl)piperidin-4-yl]guanidine |
|---|---|
| PubChem CID | 109394964 |
| Molecular Formula | C21H31FN4O |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[1-(3-fluorophenyl)piperidin-4-yl]guanidine |
| SMILES | CCN/C(=N\CCC1=CCOCC1)NC1CCN(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H31FN4O/c1-2-23-21(24-11-6-17-9-14-27-15-10-17)25-19-7-12-26(13-8-19)20-5-3-4-18(22)16-20/h3-5,9,16,19H,2,6-8,10-15H2,1H3,(H2,23,24,25) |
| InChIKey | RWGPBNFSWQRBRI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|