C17H31F2IN4O — CID 109394977
1-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 109394977) has the molecular formula C17H31F2IN4O and a molecular weight of 472.36 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109394977 |
| Molecular Formula | C17H31F2IN4O |
| Molecular Weight | 472.36 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC1=CCOCC1)NC1CCN(CC(F)F)CC1.I |
| InChI | InChI=1S/C17H30F2N4O.HI/c1-2-20-17(21-8-3-14-6-11-24-12-7-14)22-15-4-9-23(10-5-15)13-16(18)19;/h6,15-16H,2-5,7-13H2,1H3,(H2,20,21,22);1H |
| InChIKey | XWLLAAOVMJCJLP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|