C17H29F3IN3O — CID 109393937
2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide (PubChem CID 109393937) has the molecular formula C17H29F3IN3O and a molecular weight of 475.34 g/mol. Its IUPAC name is 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109393937 |
| Molecular Formula | C17H29F3IN3O |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC1=CCOCC1)NC1CCC(C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H28F3N3O.HI/c1-2-21-16(22-10-7-13-8-11-24-12-9-13)23-15-5-3-14(4-6-15)17(18,19)20;/h8,14-15H,2-7,9-12H2,1H3,(H2,21,22,23);1H |
| InChIKey | AARGFYRFDORWOQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|