C22H34FIN4O — CID 109395263
2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]guanidine;hydroiodide (PubChem CID 109395263) has the molecular formula C22H34FIN4O and a molecular weight of 516.44 g/mol. Its IUPAC name is 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109395263 |
| Molecular Formula | C22H34FIN4O |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 2-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-ethyl-3-[1-(4-fluoro-2-methylphenyl)piperidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCC1=CCOCC1)NC1CCCN(c2ccc(F)cc2C)C1.I |
| InChI | InChI=1S/C22H33FN4O.HI/c1-3-24-22(25-11-8-18-9-13-28-14-10-18)26-20-5-4-12-27(16-20)21-7-6-19(23)15-17(21)2;/h6-7,9,15,20H,3-5,8,10-14,16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | YTHCDCHJTZUWKF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|