C20H30ClIN4O — CID 109395222
1-[1-(2-chlorophenyl)piperidin-3-yl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 109395222) has the molecular formula C20H30ClIN4O and a molecular weight of 504.84 g/mol. Its IUPAC name is 1-[1-(2-chlorophenyl)piperidin-3-yl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(2-chlorophenyl)piperidin-3-yl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109395222 |
| Molecular Formula | C20H30ClIN4O |
| Molecular Weight | 504.84 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 1-[1-(2-chlorophenyl)piperidin-3-yl]-3-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1=CCOCC1)NC1CCCN(c2ccccc2Cl)C1.I |
| InChI | InChI=1S/C20H29ClN4O.HI/c1-22-20(23-11-8-16-9-13-26-14-10-16)24-17-5-4-12-25(15-17)19-7-3-2-6-18(19)21;/h2-3,6-7,9,17H,4-5,8,10-15H2,1H3,(H2,22,23,24);1H |
| InChIKey | WNWJYUBPJWXZLS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|