C17H31N3O — CID 109395578
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-(3-ethylcyclohexyl)-2-methylguanidine (PubChem CID 109395578) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-(3-ethylcyclohexyl)-2-methylguanidine.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-(3-ethylcyclohexyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109395578 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-3-(3-ethylcyclohexyl)-2-methylguanidine |
| SMILES | CCC1CCCC(N/C(=N/C)NCCC2=CCOCC2)C1 |
| InChI | InChI=1S/C17H31N3O/c1-3-14-5-4-6-16(13-14)20-17(18-2)19-10-7-15-8-11-21-12-9-15/h8,14,16H,3-7,9-13H2,1-2H3,(H2,18,19,20) |
| InChIKey | FOKUCBAGEIMPPD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|