C21H26FN7 — CID 111992629
1-[1-(3-fluorophenyl)piperidin-4-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111992629) has the molecular formula C21H26FN7 and a molecular weight of 395.49 g/mol. Its IUPAC name is 1-[1-(3-fluorophenyl)piperidin-4-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 1-[1-(3-fluorophenyl)piperidin-4-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111992629 |
| Molecular Formula | C21H26FN7 |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-[1-(3-fluorophenyl)piperidin-4-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCc1nnc2ccccn12)NC1CCN(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H26FN7/c1-23-21(24-11-8-20-27-26-19-7-2-3-12-29(19)20)25-17-9-13-28(14-10-17)18-6-4-5-16(22)15-18/h2-7,12,15,17H,8-11,13-14H2,1H3,(H2,23,24,25) |
| InChIKey | JORAYFXVWOORLA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|