C22H28ClFIN7 — CID 111994790
1-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111994790) has the molecular formula C22H28ClFIN7 and a molecular weight of 571.87 g/mol. Its IUPAC name is 1-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111994790 |
| Molecular Formula | C22H28ClFIN7 |
| Molecular Weight | 571.87 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]piperidin-3-yl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nnc2ccccn12)NC1CCCN(Cc2ccc(F)cc2Cl)C1.I |
| InChI | InChI=1S/C22H27ClFN7.HI/c1-25-22(26-10-9-21-29-28-20-6-2-3-12-31(20)21)27-18-5-4-11-30(15-18)14-16-7-8-17(24)13-19(16)23;/h2-3,6-8,12-13,18H,4-5,9-11,14-15H2,1H3,(H2,25,26,27);1H |
| InChIKey | IANOQVXJYWWVOE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|